C22H23ClFN5O2 — CID 141260197
N-[1-[[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]methyl-ethylamino]cyclopropyl]formamide (PubChem CID 141260197) has the molecular formula C22H23ClFN5O2 and a molecular weight of 443.91 g/mol. Its IUPAC name is N-[1-[[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]methyl-ethylamino]cyclopropyl]formamide.
| Compound Name | N-[1-[[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]methyl-ethylamino]cyclopropyl]formamide |
|---|---|
| PubChem CID | 141260197 |
| Molecular Formula | C22H23ClFN5O2 |
| Molecular Weight | 443.91 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | N-[1-[[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]methyl-ethylamino]cyclopropyl]formamide |
| SMILES | CCN(Cc1cc2c(Nc3cccc(Cl)c3F)ncnc2cc1OC)C1(NC=O)CC1 |
| InChI | InChI=1S/C22H23ClFN5O2/c1-3-29(22(7-8-22)27-13-30)11-14-9-15-18(10-19(14)31-2)25-12-26-21(15)28-17-6-4-5-16(23)20(17)24/h4-6,9-10,12-13H,3,7-8,11H2,1-2H3,(H,27,30)(H,25,26,28) |
| InChIKey | FKJNLVYPNQSXJL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.91 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|