C25H24ClN5O2S — CID 171474949
N-[2-[5-chloro-2-(pyridin-2-ylmethoxy)anilino]-1,3-benzothiazol-6-yl]-4-(dimethylamino)but-2-enamide (PubChem CID 171474949) has the molecular formula C25H24ClN5O2S and a molecular weight of 494.02 g/mol. Its IUPAC name is N-[2-[5-chloro-2-(pyridin-2-ylmethoxy)anilino]-1,3-benzothiazol-6-yl]-4-(dimethylamino)but-2-enamide.
| Compound Name | N-[2-[5-chloro-2-(pyridin-2-ylmethoxy)anilino]-1,3-benzothiazol-6-yl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 171474949 |
| Molecular Formula | C25H24ClN5O2S |
| Molecular Weight | 494.02 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | N-[2-[5-chloro-2-(pyridin-2-ylmethoxy)anilino]-1,3-benzothiazol-6-yl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)CC=CC(=O)Nc1ccc2nc(Nc3cc(Cl)ccc3OCc3ccccn3)sc2c1 |
| InChI | InChI=1S/C25H24ClN5O2S/c1-31(2)13-5-7-24(32)28-18-9-10-20-23(15-18)34-25(29-20)30-21-14-17(26)8-11-22(21)33-16-19-6-3-4-12-27-19/h3-12,14-15H,13,16H2,1-2H3,(H,28,32)(H,29,30) |
| InChIKey | ZTPILXZOIYOEJD-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.02 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|