C32H36FN5O2S — CID 171474951
2-ethylidene-N-[2-[3-fluoro-4-(pyridin-2-ylmethoxy)anilino]-1,3-benzothiazol-6-yl]-6-piperidin-1-ylhexanamide (PubChem CID 171474951) has the molecular formula C32H36FN5O2S and a molecular weight of 573.74 g/mol. Its IUPAC name is 2-ethylidene-N-[2-[3-fluoro-4-(pyridin-2-ylmethoxy)anilino]-1,3-benzothiazol-6-yl]-6-piperidin-1-ylhexanamide.
| Compound Name | 2-ethylidene-N-[2-[3-fluoro-4-(pyridin-2-ylmethoxy)anilino]-1,3-benzothiazol-6-yl]-6-piperidin-1-ylhexanamide |
|---|---|
| PubChem CID | 171474951 |
| Molecular Formula | C32H36FN5O2S |
| Molecular Weight | 573.74 g/mol |
| Exact Mass | 573.26 |
| IUPAC Name | 2-ethylidene-N-[2-[3-fluoro-4-(pyridin-2-ylmethoxy)anilino]-1,3-benzothiazol-6-yl]-6-piperidin-1-ylhexanamide |
| SMILES | CC=C(CCCCN1CCCCC1)C(=O)Nc1ccc2nc(Nc3ccc(OCc4ccccn4)c(F)c3)sc2c1 |
| InChI | InChI=1S/C32H36FN5O2S/c1-2-23(10-5-9-19-38-17-7-3-8-18-38)31(39)35-25-12-14-28-30(21-25)41-32(37-28)36-24-13-15-29(27(33)20-24)40-22-26-11-4-6-16-34-26/h2,4,6,11-16,20-21H,3,5,7-10,17-19,22H2,1H3,(H,35,39)(H,36,37) |
| InChIKey | LATWRCPSAHQLGU-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.74 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|