C19H22FN3O4 — CID 122086111
4-[[3-fluoro-4-(pyridin-2-ylmethoxy)phenyl]carbamoylamino]-4-methylpentanoic acid (PubChem CID 122086111) has the molecular formula C19H22FN3O4 and a molecular weight of 375.40 g/mol. Its IUPAC name is 4-[[3-fluoro-4-(pyridin-2-ylmethoxy)phenyl]carbamoylamino]-4-methylpentanoic acid.
| Compound Name | 4-[[3-fluoro-4-(pyridin-2-ylmethoxy)phenyl]carbamoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122086111 |
| Molecular Formula | C19H22FN3O4 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 4-[[3-fluoro-4-(pyridin-2-ylmethoxy)phenyl]carbamoylamino]-4-methylpentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)Nc1ccc(OCc2ccccn2)c(F)c1 |
| InChI | InChI=1S/C19H22FN3O4/c1-19(2,9-8-17(24)25)23-18(26)22-13-6-7-16(15(20)11-13)27-12-14-5-3-4-10-21-14/h3-7,10-11H,8-9,12H2,1-2H3,(H,24,25)(H2,22,23,26) |
| InChIKey | WXICHHWOJIZQTI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |