C17H10FN5O — CID 168609787
2-[3-fluoro-4-(pyridin-2-ylmethoxy)anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168609787) has the molecular formula C17H10FN5O and a molecular weight of 319.30 g/mol. Its IUPAC name is 2-[3-fluoro-4-(pyridin-2-ylmethoxy)anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[3-fluoro-4-(pyridin-2-ylmethoxy)anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168609787 |
| Molecular Formula | C17H10FN5O |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 2-[3-fluoro-4-(pyridin-2-ylmethoxy)anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc(OCc2ccccn2)c(F)c1 |
| InChI | InChI=1S/C17H10FN5O/c18-15-7-13(23-16(10-21)12(8-19)9-20)4-5-17(15)24-11-14-3-1-2-6-22-14/h1-7,23H,11H2 |
| InChIKey | MULNYUOYEURNOL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 105.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|