C32H37N5O3S — CID 175547882
(E)-N-butyl-N-[2-[3-methyl-4-(pyridin-2-ylmethoxy)anilino]-1,3-benzothiazol-6-yl]-2-morpholin-4-ylbut-2-enamide (PubChem CID 175547882) has the molecular formula C32H37N5O3S and a molecular weight of 571.75 g/mol. Its IUPAC name is (E)-N-butyl-N-[2-[3-methyl-4-(pyridin-2-ylmethoxy)anilino]-1,3-benzothiazol-6-yl]-2-morpholin-4-ylbut-2-enamide.
| Compound Name | (E)-N-butyl-N-[2-[3-methyl-4-(pyridin-2-ylmethoxy)anilino]-1,3-benzothiazol-6-yl]-2-morpholin-4-ylbut-2-enamide |
|---|---|
| PubChem CID | 175547882 |
| Molecular Formula | C32H37N5O3S |
| Molecular Weight | 571.75 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | (E)-N-butyl-N-[2-[3-methyl-4-(pyridin-2-ylmethoxy)anilino]-1,3-benzothiazol-6-yl]-2-morpholin-4-ylbut-2-enamide |
| SMILES | C/C=C(\C(=O)N(CCCC)c1ccc2nc(Nc3ccc(OCc4ccccn4)c(C)c3)sc2c1)N1CCOCC1 |
| InChI | InChI=1S/C32H37N5O3S/c1-4-6-15-37(31(38)28(5-2)36-16-18-39-19-17-36)26-11-12-27-30(21-26)41-32(35-27)34-24-10-13-29(23(3)20-24)40-22-25-9-7-8-14-33-25/h5,7-14,20-21H,4,6,15-19,22H2,1-3H3,(H,34,35)/b28-5+ |
| InChIKey | KYBCYCICGRZYNB-RSLIBCCBSA-N |
| XLogP | 6.69 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.75 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|