C17H20Cl3N3O3 — CID 119867098
N-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]morpholine-2-carboxamide;dihydrochloride (PubChem CID 119867098) has the molecular formula C17H20Cl3N3O3 and a molecular weight of 420.72 g/mol. Its IUPAC name is N-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]morpholine-2-carboxamide;dihydrochloride.
| Compound Name | N-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]morpholine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119867098 |
| Molecular Formula | C17H20Cl3N3O3 |
| Molecular Weight | 420.72 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | N-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]morpholine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Nc1ccc(OCc2ccccn2)c(Cl)c1)C1CNCCO1 |
| InChI | InChI=1S/C17H18ClN3O3.2ClH/c18-14-9-12(21-17(22)16-10-19-7-8-23-16)4-5-15(14)24-11-13-3-1-2-6-20-13;;/h1-6,9,16,19H,7-8,10-11H2,(H,21,22);2*1H |
| InChIKey | CETFFHGAPMBBPH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.72 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |