C17H21Cl2N3O3 — CID 119846119
N-[3-(pyridin-2-ylmethoxy)phenyl]morpholine-2-carboxamide;dihydrochloride (PubChem CID 119846119) has the molecular formula C17H21Cl2N3O3 and a molecular weight of 386.28 g/mol. Its IUPAC name is N-[3-(pyridin-2-ylmethoxy)phenyl]morpholine-2-carboxamide;dihydrochloride.
| Compound Name | N-[3-(pyridin-2-ylmethoxy)phenyl]morpholine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119846119 |
| Molecular Formula | C17H21Cl2N3O3 |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N-[3-(pyridin-2-ylmethoxy)phenyl]morpholine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Nc1cccc(OCc2ccccn2)c1)C1CNCCO1 |
| InChI | InChI=1S/C17H19N3O3.2ClH/c21-17(16-11-18-8-9-22-16)20-13-5-3-6-15(10-13)23-12-14-4-1-2-7-19-14;;/h1-7,10,16,18H,8-9,11-12H2,(H,20,21);2*1H |
| InChIKey | SCNIAPDHKJIZAP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |