C19H20N2O5 — CID 119729240
N-[3-(1,3-benzodioxol-5-yloxymethyl)phenyl]morpholine-2-carboxamide (PubChem CID 119729240) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is N-[3-(1,3-benzodioxol-5-yloxymethyl)phenyl]morpholine-2-carboxamide.
| Compound Name | N-[3-(1,3-benzodioxol-5-yloxymethyl)phenyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 119729240 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | N-[3-(1,3-benzodioxol-5-yloxymethyl)phenyl]morpholine-2-carboxamide |
| SMILES | O=C(Nc1cccc(COc2ccc3c(c2)OCO3)c1)C1CNCCO1 |
| InChI | InChI=1S/C19H20N2O5/c22-19(18-10-20-6-7-23-18)21-14-3-1-2-13(8-14)11-24-15-4-5-16-17(9-15)26-12-25-16/h1-5,8-9,18,20H,6-7,10-12H2,(H,21,22) |
| InChIKey | VOIVTSRMVSFMIC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |