C12H16Cl2N2O2S — CID 119772470
N-(3-chloro-4-methylsulfanylphenyl)morpholine-2-carboxamide;hydrochloride (PubChem CID 119772470) has the molecular formula C12H16Cl2N2O2S and a molecular weight of 323.25 g/mol. Its IUPAC name is N-(3-chloro-4-methylsulfanylphenyl)morpholine-2-carboxamide;hydrochloride.
| Compound Name | N-(3-chloro-4-methylsulfanylphenyl)morpholine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119772470 |
| Molecular Formula | C12H16Cl2N2O2S |
| Molecular Weight | 323.25 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | N-(3-chloro-4-methylsulfanylphenyl)morpholine-2-carboxamide;hydrochloride |
| SMILES | CSc1ccc(NC(=O)C2CNCCO2)cc1Cl.Cl |
| InChI | InChI=1S/C12H15ClN2O2S.ClH/c1-18-11-3-2-8(6-9(11)13)15-12(16)10-7-14-4-5-17-10;/h2-3,6,10,14H,4-5,7H2,1H3,(H,15,16);1H |
| InChIKey | FSOUTCCEUFPGRD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |