C25H30N4O6 — CID 46793012
[2-oxo-2-[[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]ethyl] 5-nitro-2-piperidin-1-ylbenzoate (PubChem CID 46793012) has the molecular formula C25H30N4O6 and a molecular weight of 482.54 g/mol. Its IUPAC name is [2-oxo-2-[[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]ethyl] 5-nitro-2-piperidin-1-ylbenzoate.
| Compound Name | [2-oxo-2-[[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]ethyl] 5-nitro-2-piperidin-1-ylbenzoate |
|---|---|
| PubChem CID | 46793012 |
| Molecular Formula | C25H30N4O6 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | [2-oxo-2-[[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]ethyl] 5-nitro-2-piperidin-1-ylbenzoate |
| SMILES | Cc1cc(C)c(NC(=O)CNC(=O)COC(=O)c2cc([N+](=O)[O-])ccc2N2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C25H30N4O6/c1-16-11-17(2)24(18(3)12-16)27-22(30)14-26-23(31)15-35-25(32)20-13-19(29(33)34)7-8-21(20)28-9-5-4-6-10-28/h7-8,11-13H,4-6,9-10,14-15H2,1-3H3,(H,26,31)(H,27,30) |
| InChIKey | GIJBZQJNKMFUPP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|