C15H14N4O8S — CID 55834843
methyl 5-nitro-2-oxo-1-[2-oxo-2-(4-sulfamoylanilino)ethyl]pyridine-3-carboxylate (PubChem CID 55834843) has the molecular formula C15H14N4O8S and a molecular weight of 410.36 g/mol. Its IUPAC name is methyl 5-nitro-2-oxo-1-[2-oxo-2-(4-sulfamoylanilino)ethyl]pyridine-3-carboxylate.
| Compound Name | methyl 5-nitro-2-oxo-1-[2-oxo-2-(4-sulfamoylanilino)ethyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 55834843 |
| Molecular Formula | C15H14N4O8S |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | methyl 5-nitro-2-oxo-1-[2-oxo-2-(4-sulfamoylanilino)ethyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])cn(CC(=O)Nc2ccc(S(N)(=O)=O)cc2)c1=O |
| InChI | InChI=1S/C15H14N4O8S/c1-27-15(22)12-6-10(19(23)24)7-18(14(12)21)8-13(20)17-9-2-4-11(5-3-9)28(16,25)26/h2-7H,8H2,1H3,(H,17,20)(H2,16,25,26) |
| InChIKey | JQVJPNUYPDTSMM-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 180.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|