C18H15N5O7S — CID 16963563
2-[(4Z)-4-[(4-nitrophenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 16963563) has the molecular formula C18H15N5O7S and a molecular weight of 445.41 g/mol. Its IUPAC name is 2-[(4Z)-4-[(4-nitrophenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(4Z)-4-[(4-nitrophenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 16963563 |
| Molecular Formula | C18H15N5O7S |
| Molecular Weight | 445.41 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 2-[(4Z)-4-[(4-nitrophenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CN2C(=O)N/C(=C\c3ccc([N+](=O)[O-])cc3)C2=O)cc1 |
| InChI | InChI=1S/C18H15N5O7S/c19-31(29,30)14-7-3-12(4-8-14)20-16(24)10-22-17(25)15(21-18(22)26)9-11-1-5-13(6-2-11)23(27)28/h1-9H,10H2,(H,20,24)(H,21,26)(H2,19,29,30)/b15-9- |
| InChIKey | YNXISDPJQPPGJV-DHDCSXOGSA-N |
| XLogP | 0.77 |
| TPSA | 181.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.41 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|