C21H17ClN4O6 — CID 39840542
2-[(4Z)-4-[(Z)-2-chloro-3-(4-nitrophenyl)prop-2-enylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 39840542) has the molecular formula C21H17ClN4O6 and a molecular weight of 456.84 g/mol. Its IUPAC name is 2-[(4Z)-4-[(Z)-2-chloro-3-(4-nitrophenyl)prop-2-enylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(4Z)-4-[(Z)-2-chloro-3-(4-nitrophenyl)prop-2-enylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 39840542 |
| Molecular Formula | C21H17ClN4O6 |
| Molecular Weight | 456.84 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 2-[(4Z)-4-[(Z)-2-chloro-3-(4-nitrophenyl)prop-2-enylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CN2C(=O)N/C(=C\C(Cl)=C\c3ccc([N+](=O)[O-])cc3)C2=O)cc1 |
| InChI | InChI=1S/C21H17ClN4O6/c1-32-17-8-4-15(5-9-17)23-19(27)12-25-20(28)18(24-21(25)29)11-14(22)10-13-2-6-16(7-3-13)26(30)31/h2-11H,12H2,1H3,(H,23,27)(H,24,29)/b14-10-,18-11- |
| InChIKey | YNHYMMFWNBFFNZ-LQHTZKGQSA-N |
| XLogP | 3.26 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.84 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|