C18H13BrN4O6 — CID 16797924
2-[(4Z)-4-[(5-bromo-2-hydroxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-nitrophenyl)acetamide (PubChem CID 16797924) has the molecular formula C18H13BrN4O6 and a molecular weight of 461.23 g/mol. Its IUPAC name is 2-[(4Z)-4-[(5-bromo-2-hydroxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[(4Z)-4-[(5-bromo-2-hydroxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 16797924 |
| Molecular Formula | C18H13BrN4O6 |
| Molecular Weight | 461.23 g/mol |
| Exact Mass | 460.00 |
| IUPAC Name | 2-[(4Z)-4-[(5-bromo-2-hydroxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-nitrophenyl)acetamide |
| SMILES | O=C(CN1C(=O)N/C(=C\c2cc(Br)ccc2O)C1=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H13BrN4O6/c19-11-1-6-15(24)10(7-11)8-14-17(26)22(18(27)21-14)9-16(25)20-12-2-4-13(5-3-12)23(28)29/h1-8,24H,9H2,(H,20,25)(H,21,27)/b14-8- |
| InChIKey | TVRFPUKBOIISOW-ZSOIEALJSA-N |
| XLogP | 2.59 |
| TPSA | 141.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.23 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|