C19H26N2O4S — CID 108978598
1-N-(2,3-dimethylphenyl)-1-N'-(1,1-dioxothiolan-3-yl)-1-N'-ethylcyclopropane-1,1-dicarboxamide (PubChem CID 108978598) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is 1-N-(2,3-dimethylphenyl)-1-N'-(1,1-dioxothiolan-3-yl)-1-N'-ethylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-(2,3-dimethylphenyl)-1-N'-(1,1-dioxothiolan-3-yl)-1-N'-ethylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108978598 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 1-N-(2,3-dimethylphenyl)-1-N'-(1,1-dioxothiolan-3-yl)-1-N'-ethylcyclopropane-1,1-dicarboxamide |
| SMILES | CCN(C(=O)C1(C(=O)Nc2cccc(C)c2C)CC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H26N2O4S/c1-4-21(15-8-11-26(24,25)12-15)18(23)19(9-10-19)17(22)20-16-7-5-6-13(2)14(16)3/h5-7,15H,4,8-12H2,1-3H3,(H,20,22) |
| InChIKey | FNCTUDUNMJEAAA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|