C17H26N2O4S — CID 97098685
1-[(3S)-1,1-dioxothiolan-3-yl]-3-(4-ethoxy-2-methylphenyl)-1-propylurea (PubChem CID 97098685) has the molecular formula C17H26N2O4S and a molecular weight of 354.47 g/mol. Its IUPAC name is 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(4-ethoxy-2-methylphenyl)-1-propylurea.
| Compound Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(4-ethoxy-2-methylphenyl)-1-propylurea |
|---|---|
| PubChem CID | 97098685 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(4-ethoxy-2-methylphenyl)-1-propylurea |
| SMILES | CCCN(C(=O)Nc1ccc(OCC)cc1C)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H26N2O4S/c1-4-9-19(14-8-10-24(21,22)12-14)17(20)18-16-7-6-15(23-5-2)11-13(16)3/h6-7,11,14H,4-5,8-10,12H2,1-3H3,(H,18,20)/t14-/m0/s1 |
| InChIKey | MYGJNBNXRGKOON-AWEZNQCLSA-N |
| XLogP | 2.82 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |