C22H33NO4S — CID 40722854
N-butyl-2-(4-cyclohexylphenoxy)-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 40722854) has the molecular formula C22H33NO4S and a molecular weight of 407.58 g/mol. Its IUPAC name is N-butyl-2-(4-cyclohexylphenoxy)-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | N-butyl-2-(4-cyclohexylphenoxy)-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 40722854 |
| Molecular Formula | C22H33NO4S |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | N-butyl-2-(4-cyclohexylphenoxy)-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | CCCCN(C(=O)COc1ccc(C2CCCCC2)cc1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H33NO4S/c1-2-3-14-23(20-13-15-28(25,26)17-20)22(24)16-27-21-11-9-19(10-12-21)18-7-5-4-6-8-18/h9-12,18,20H,2-8,13-17H2,1H3/t20-/m0/s1 |
| InChIKey | SQGMAQLEPMTAHR-FQEVSTJZSA-N |
| XLogP | 3.93 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |