C20H30N2O4S — CID 108964754
N-(2-tert-butylphenyl)-N'-(1,1-dioxothiolan-3-yl)-N',2,2-trimethylpropanediamide (PubChem CID 108964754) has the molecular formula C20H30N2O4S and a molecular weight of 394.54 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-N'-(1,1-dioxothiolan-3-yl)-N',2,2-trimethylpropanediamide.
| Compound Name | N-(2-tert-butylphenyl)-N'-(1,1-dioxothiolan-3-yl)-N',2,2-trimethylpropanediamide |
|---|---|
| PubChem CID | 108964754 |
| Molecular Formula | C20H30N2O4S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N-(2-tert-butylphenyl)-N'-(1,1-dioxothiolan-3-yl)-N',2,2-trimethylpropanediamide |
| SMILES | CN(C(=O)C(C)(C)C(=O)Nc1ccccc1C(C)(C)C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H30N2O4S/c1-19(2,3)15-9-7-8-10-16(15)21-17(23)20(4,5)18(24)22(6)14-11-12-27(25,26)13-14/h7-10,14H,11-13H2,1-6H3,(H,21,23) |
| InChIKey | WXNPYVBFZQCZKV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|