C16H23N3O4S — CID 108963500
N-(1,1-dioxothiolan-3-yl)-N,2,2-trimethyl-N'-(pyridin-3-ylmethyl)propanediamide (PubChem CID 108963500) has the molecular formula C16H23N3O4S and a molecular weight of 353.44 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N,2,2-trimethyl-N'-(pyridin-3-ylmethyl)propanediamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N,2,2-trimethyl-N'-(pyridin-3-ylmethyl)propanediamide |
|---|---|
| PubChem CID | 108963500 |
| Molecular Formula | C16H23N3O4S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N,2,2-trimethyl-N'-(pyridin-3-ylmethyl)propanediamide |
| SMILES | CN(C(=O)C(C)(C)C(=O)NCc1cccnc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H23N3O4S/c1-16(2,14(20)18-10-12-5-4-7-17-9-12)15(21)19(3)13-6-8-24(22,23)11-13/h4-5,7,9,13H,6,8,10-11H2,1-3H3,(H,18,20) |
| InChIKey | JXECTBUPCGNJQZ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|