C18H26N2O4S — CID 108964740
N-(2,5-dimethylphenyl)-N'-(1,1-dioxothiolan-3-yl)-N',2,2-trimethylpropanediamide (PubChem CID 108964740) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-N'-(1,1-dioxothiolan-3-yl)-N',2,2-trimethylpropanediamide.
| Compound Name | N-(2,5-dimethylphenyl)-N'-(1,1-dioxothiolan-3-yl)-N',2,2-trimethylpropanediamide |
|---|---|
| PubChem CID | 108964740 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | N-(2,5-dimethylphenyl)-N'-(1,1-dioxothiolan-3-yl)-N',2,2-trimethylpropanediamide |
| SMILES | Cc1ccc(C)c(NC(=O)C(C)(C)C(=O)N(C)C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C18H26N2O4S/c1-12-6-7-13(2)15(10-12)19-16(21)18(3,4)17(22)20(5)14-8-9-25(23,24)11-14/h6-7,10,14H,8-9,11H2,1-5H3,(H,19,21) |
| InChIKey | SAKLFDIZTFNEJA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|