C17H26N2O2 — CID 108965970
N-tert-butyl-N'-(2,5-dimethylphenyl)-2,2-dimethylpropanediamide (PubChem CID 108965970) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is N-tert-butyl-N'-(2,5-dimethylphenyl)-2,2-dimethylpropanediamide.
| Compound Name | N-tert-butyl-N'-(2,5-dimethylphenyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108965970 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | N-tert-butyl-N'-(2,5-dimethylphenyl)-2,2-dimethylpropanediamide |
| SMILES | Cc1ccc(C)c(NC(=O)C(C)(C)C(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C17H26N2O2/c1-11-8-9-12(2)13(10-11)18-14(20)17(6,7)15(21)19-16(3,4)5/h8-10H,1-7H3,(H,18,20)(H,19,21) |
| InChIKey | YTYMMSMYKDYTDB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|