C21H23N3O3S — CID 126772219
N-(1,1-dioxothiolan-3-yl)-3-(1H-indol-5-yl)-N-(pyridin-3-ylmethyl)propanamide (PubChem CID 126772219) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-(1H-indol-5-yl)-N-(pyridin-3-ylmethyl)propanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-(1H-indol-5-yl)-N-(pyridin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 126772219 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-(1H-indol-5-yl)-N-(pyridin-3-ylmethyl)propanamide |
| SMILES | O=C(CCc1ccc2[nH]ccc2c1)N(Cc1cccnc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H23N3O3S/c25-21(6-4-16-3-5-20-18(12-16)7-10-23-20)24(14-17-2-1-9-22-13-17)19-8-11-28(26,27)15-19/h1-3,5,7,9-10,12-13,19,23H,4,6,8,11,14-15H2 |
| InChIKey | GATVYGDVGKVWCD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |