C26H32ClN3O4S — CID 92696788
3-(5-chloro-2-methoxyphenyl)-1-[(1S)-1-(7-methoxy-1-benzofuran-2-yl)ethyl]-1-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 92696788) has the molecular formula C26H32ClN3O4S and a molecular weight of 518.08 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxyphenyl)-1-[(1S)-1-(7-methoxy-1-benzofuran-2-yl)ethyl]-1-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 3-(5-chloro-2-methoxyphenyl)-1-[(1S)-1-(7-methoxy-1-benzofuran-2-yl)ethyl]-1-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 92696788 |
| Molecular Formula | C26H32ClN3O4S |
| Molecular Weight | 518.08 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | 3-(5-chloro-2-methoxyphenyl)-1-[(1S)-1-(7-methoxy-1-benzofuran-2-yl)ethyl]-1-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | COc1ccc(Cl)cc1NC(=S)N(CCCN1CCOCC1)[C@@H](C)c1cc2cccc(OC)c2o1 |
| InChI | InChI=1S/C26H32ClN3O4S/c1-18(24-16-19-6-4-7-23(32-3)25(19)34-24)30(11-5-10-29-12-14-33-15-13-29)26(35)28-21-17-20(27)8-9-22(21)31-2/h4,6-9,16-18H,5,10-15H2,1-3H3,(H,28,35)/t18-/m0/s1 |
| InChIKey | HMGBKWYIBYHTMS-SFHVURJKSA-N |
| XLogP | 5.59 |
| TPSA | 59.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.08 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|