C27H35N3O3S — CID 92696776
3-(2-ethylphenyl)-1-[(1S)-1-(7-methoxy-1-benzofuran-2-yl)ethyl]-1-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 92696776) has the molecular formula C27H35N3O3S and a molecular weight of 481.66 g/mol. Its IUPAC name is 3-(2-ethylphenyl)-1-[(1S)-1-(7-methoxy-1-benzofuran-2-yl)ethyl]-1-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 3-(2-ethylphenyl)-1-[(1S)-1-(7-methoxy-1-benzofuran-2-yl)ethyl]-1-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 92696776 |
| Molecular Formula | C27H35N3O3S |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | 3-(2-ethylphenyl)-1-[(1S)-1-(7-methoxy-1-benzofuran-2-yl)ethyl]-1-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | CCc1ccccc1NC(=S)N(CCCN1CCOCC1)[C@@H](C)c1cc2cccc(OC)c2o1 |
| InChI | InChI=1S/C27H35N3O3S/c1-4-21-9-5-6-11-23(21)28-27(34)30(14-8-13-29-15-17-32-18-16-29)20(2)25-19-22-10-7-12-24(31-3)26(22)33-25/h5-7,9-12,19-20H,4,8,13-18H2,1-3H3,(H,28,34)/t20-/m0/s1 |
| InChIKey | SEDDMGUQDQWHBW-FQEVSTJZSA-N |
| XLogP | 5.49 |
| TPSA | 50.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|