C16H18F3N3 — CID 139917499
2-N-[[4-(dimethylamino)phenyl]methyl]-4-(trifluoromethyl)benzene-1,2-diamine (PubChem CID 139917499) has the molecular formula C16H18F3N3 and a molecular weight of 309.34 g/mol. Its IUPAC name is 2-N-[[4-(dimethylamino)phenyl]methyl]-4-(trifluoromethyl)benzene-1,2-diamine.
| Compound Name | 2-N-[[4-(dimethylamino)phenyl]methyl]-4-(trifluoromethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 139917499 |
| Molecular Formula | C16H18F3N3 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-N-[[4-(dimethylamino)phenyl]methyl]-4-(trifluoromethyl)benzene-1,2-diamine |
| SMILES | CN(C)c1ccc(CNc2cc(C(F)(F)F)ccc2N)cc1 |
| InChI | InChI=1S/C16H18F3N3/c1-22(2)13-6-3-11(4-7-13)10-21-15-9-12(16(17,18)19)5-8-14(15)20/h3-9,21H,10,20H2,1-2H3 |
| InChIKey | COIZQASAXLZSPB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|