C18H21N3O2S — CID 8619344
4-[2-[(2,6-diethylphenyl)carbamothioyl]hydrazinyl]benzoic acid (PubChem CID 8619344) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 4-[2-[(2,6-diethylphenyl)carbamothioyl]hydrazinyl]benzoic acid.
| Compound Name | 4-[2-[(2,6-diethylphenyl)carbamothioyl]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 8619344 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 4-[2-[(2,6-diethylphenyl)carbamothioyl]hydrazinyl]benzoic acid |
| SMILES | CCc1cccc(CC)c1NC(=S)NNc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C18H21N3O2S/c1-3-12-6-5-7-13(4-2)16(12)19-18(24)21-20-15-10-8-14(9-11-15)17(22)23/h5-11,20H,3-4H2,1-2H3,(H,22,23)(H2,19,21,24) |
| InChIKey | VHGYMMLLOBSZCG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_urea_D(8)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|