C21H25NO4S — CID 123106804
4-[[1-(2,6-diethylanilino)-1-oxopropan-2-yl]sulfinylmethyl]benzoic acid (PubChem CID 123106804) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is 4-[[1-(2,6-diethylanilino)-1-oxopropan-2-yl]sulfinylmethyl]benzoic acid.
| Compound Name | 4-[[1-(2,6-diethylanilino)-1-oxopropan-2-yl]sulfinylmethyl]benzoic acid |
|---|---|
| PubChem CID | 123106804 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 4-[[1-(2,6-diethylanilino)-1-oxopropan-2-yl]sulfinylmethyl]benzoic acid |
| SMILES | CCc1cccc(CC)c1NC(=O)C(C)S(=O)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H25NO4S/c1-4-16-7-6-8-17(5-2)19(16)22-20(23)14(3)27(26)13-15-9-11-18(12-10-15)21(24)25/h6-12,14H,4-5,13H2,1-3H3,(H,22,23)(H,24,25) |
| InChIKey | AWYYDIUFBIVAEX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |