C14H18O6S — CID 123106891
4-[[1-(2-methoxyethoxy)-1-oxopropan-2-yl]sulfinylmethyl]benzoic acid (PubChem CID 123106891) has the molecular formula C14H18O6S and a molecular weight of 314.36 g/mol. Its IUPAC name is 4-[[1-(2-methoxyethoxy)-1-oxopropan-2-yl]sulfinylmethyl]benzoic acid.
| Compound Name | 4-[[1-(2-methoxyethoxy)-1-oxopropan-2-yl]sulfinylmethyl]benzoic acid |
|---|---|
| PubChem CID | 123106891 |
| Molecular Formula | C14H18O6S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 4-[[1-(2-methoxyethoxy)-1-oxopropan-2-yl]sulfinylmethyl]benzoic acid |
| SMILES | COCCOC(=O)C(C)S(=O)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C14H18O6S/c1-10(14(17)20-8-7-19-2)21(18)9-11-3-5-12(6-4-11)13(15)16/h3-6,10H,7-9H2,1-2H3,(H,15,16) |
| InChIKey | HHYISDLEBNPVIZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|