C18H16F3NO4S — CID 123106792
4-[[1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl]sulfinylmethyl]benzoic acid (PubChem CID 123106792) has the molecular formula C18H16F3NO4S and a molecular weight of 399.39 g/mol. Its IUPAC name is 4-[[1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl]sulfinylmethyl]benzoic acid.
| Compound Name | 4-[[1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl]sulfinylmethyl]benzoic acid |
|---|---|
| PubChem CID | 123106792 |
| Molecular Formula | C18H16F3NO4S |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 4-[[1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl]sulfinylmethyl]benzoic acid |
| SMILES | CC(C(=O)Nc1ccccc1C(F)(F)F)S(=O)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C18H16F3NO4S/c1-11(27(26)10-12-6-8-13(9-7-12)17(24)25)16(23)22-15-5-3-2-4-14(15)18(19,20)21/h2-9,11H,10H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | CGNNJJRYEDYAML-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |