C16H16FNO2S — CID 95169351
(2R)-2-[(R)-benzylsulfinyl]-N-(2-fluorophenyl)propanamide (PubChem CID 95169351) has the molecular formula C16H16FNO2S and a molecular weight of 305.37 g/mol. Its IUPAC name is (2R)-2-[(R)-benzylsulfinyl]-N-(2-fluorophenyl)propanamide.
| Compound Name | (2R)-2-[(R)-benzylsulfinyl]-N-(2-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 95169351 |
| Molecular Formula | C16H16FNO2S |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | (2R)-2-[(R)-benzylsulfinyl]-N-(2-fluorophenyl)propanamide |
| SMILES | C[C@H](C(=O)Nc1ccccc1F)[S@](=O)Cc1ccccc1 |
| InChI | InChI=1S/C16H16FNO2S/c1-12(21(20)11-13-7-3-2-4-8-13)16(19)18-15-10-6-5-9-14(15)17/h2-10,12H,11H2,1H3,(H,18,19)/t12-,21-/m1/s1 |
| InChIKey | KDJPWKMHRWJVBG-XUSGNXJCSA-N |
| XLogP | 3.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |