C16H14ClF2NO2S — CID 95169378
(2S)-2-[(R)-(2-chloro-6-fluorophenyl)methylsulfinyl]-N-(2-fluorophenyl)propanamide (PubChem CID 95169378) has the molecular formula C16H14ClF2NO2S and a molecular weight of 357.81 g/mol. Its IUPAC name is (2S)-2-[(R)-(2-chloro-6-fluorophenyl)methylsulfinyl]-N-(2-fluorophenyl)propanamide.
| Compound Name | (2S)-2-[(R)-(2-chloro-6-fluorophenyl)methylsulfinyl]-N-(2-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 95169378 |
| Molecular Formula | C16H14ClF2NO2S |
| Molecular Weight | 357.81 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | (2S)-2-[(R)-(2-chloro-6-fluorophenyl)methylsulfinyl]-N-(2-fluorophenyl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccccc1F)[S@](=O)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C16H14ClF2NO2S/c1-10(16(21)20-15-8-3-2-6-14(15)19)23(22)9-11-12(17)5-4-7-13(11)18/h2-8,10H,9H2,1H3,(H,20,21)/t10-,23+/m0/s1 |
| InChIKey | WKOKUNUKFHUVQH-SDWAUSNYSA-N |
| XLogP | 3.89 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.81 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |