C15H19ClFNO2S — CID 95599486
(2R)-2-[(R)-(2-chloro-6-fluorophenyl)methylsulfinyl]-N-cyclopentylpropanamide (PubChem CID 95599486) has the molecular formula C15H19ClFNO2S and a molecular weight of 331.84 g/mol. Its IUPAC name is (2R)-2-[(R)-(2-chloro-6-fluorophenyl)methylsulfinyl]-N-cyclopentylpropanamide.
| Compound Name | (2R)-2-[(R)-(2-chloro-6-fluorophenyl)methylsulfinyl]-N-cyclopentylpropanamide |
|---|---|
| PubChem CID | 95599486 |
| Molecular Formula | C15H19ClFNO2S |
| Molecular Weight | 331.84 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | (2R)-2-[(R)-(2-chloro-6-fluorophenyl)methylsulfinyl]-N-cyclopentylpropanamide |
| SMILES | C[C@H](C(=O)NC1CCCC1)[S@](=O)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C15H19ClFNO2S/c1-10(15(19)18-11-5-2-3-6-11)21(20)9-12-13(16)7-4-8-14(12)17/h4,7-8,10-11H,2-3,5-6,9H2,1H3,(H,18,19)/t10-,21-/m1/s1 |
| InChIKey | BZSNTSZIOQDDTO-LADRHHBVSA-N |
| XLogP | 3.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.84 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |