C18H19BrN2OS — CID 3004250
4-bromo-N-[(2,6-diethylphenyl)carbamothioyl]benzamide (PubChem CID 3004250) has the molecular formula C18H19BrN2OS and a molecular weight of 391.33 g/mol. Its IUPAC name is 4-bromo-N-[(2,6-diethylphenyl)carbamothioyl]benzamide.
| Compound Name | 4-bromo-N-[(2,6-diethylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3004250 |
| Molecular Formula | C18H19BrN2OS |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 4-bromo-N-[(2,6-diethylphenyl)carbamothioyl]benzamide |
| SMILES | CCc1cccc(CC)c1NC(=S)NC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H19BrN2OS/c1-3-12-6-5-7-13(4-2)16(12)20-18(23)21-17(22)14-8-10-15(19)11-9-14/h5-11H,3-4H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | PHNGFSCBIVNEKD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|