C16H14BrIN2OS — CID 4000278
N-[(4-bromo-2-iodophenyl)carbamothioyl]-4-ethylbenzamide (PubChem CID 4000278) has the molecular formula C16H14BrIN2OS and a molecular weight of 489.18 g/mol. Its IUPAC name is N-[(4-bromo-2-iodophenyl)carbamothioyl]-4-ethylbenzamide.
| Compound Name | N-[(4-bromo-2-iodophenyl)carbamothioyl]-4-ethylbenzamide |
|---|---|
| PubChem CID | 4000278 |
| Molecular Formula | C16H14BrIN2OS |
| Molecular Weight | 489.18 g/mol |
| Exact Mass | 487.91 |
| IUPAC Name | N-[(4-bromo-2-iodophenyl)carbamothioyl]-4-ethylbenzamide |
| SMILES | CCc1ccc(C(=O)NC(=S)Nc2ccc(Br)cc2I)cc1 |
| InChI | InChI=1S/C16H14BrIN2OS/c1-2-10-3-5-11(6-4-10)15(21)20-16(22)19-14-8-7-12(17)9-13(14)18/h3-9H,2H2,1H3,(H2,19,20,21,22) |
| InChIKey | CBICPTJYXYNMQH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.18 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|