C20H22F2N2O2 — CID 11574057
2-(3,4-difluorophenyl)-N-(2,6-dimethyl-4-morpholin-4-ylphenyl)acetamide (PubChem CID 11574057) has the molecular formula C20H22F2N2O2 and a molecular weight of 360.40 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-N-(2,6-dimethyl-4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-(3,4-difluorophenyl)-N-(2,6-dimethyl-4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 11574057 |
| Molecular Formula | C20H22F2N2O2 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-(3,4-difluorophenyl)-N-(2,6-dimethyl-4-morpholin-4-ylphenyl)acetamide |
| SMILES | Cc1cc(N2CCOCC2)cc(C)c1NC(=O)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H22F2N2O2/c1-13-9-16(24-5-7-26-8-6-24)10-14(2)20(13)23-19(25)12-15-3-4-17(21)18(22)11-15/h3-4,9-11H,5-8,12H2,1-2H3,(H,23,25) |
| InChIKey | IRYKZAAWGNDZJR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |