C19H25N2O+ — CID 8717688
4-(2-methylpyridin-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)butanamide (PubChem CID 8717688) has the molecular formula C19H25N2O+ and a molecular weight of 297.42 g/mol. Its IUPAC name is 4-(2-methylpyridin-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)butanamide.
| Compound Name | 4-(2-methylpyridin-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)butanamide |
|---|---|
| PubChem CID | 8717688 |
| Molecular Formula | C19H25N2O+ |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | 4-(2-methylpyridin-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)butanamide |
| SMILES | Cc1cc(C)c(NC(=O)CCC[n+]2ccccc2C)c(C)c1 |
| InChI | InChI=1S/C19H24N2O/c1-14-12-15(2)19(16(3)13-14)20-18(22)9-7-11-21-10-6-5-8-17(21)4/h5-6,8,10,12-13H,7,9,11H2,1-4H3/p+1 |
| InChIKey | JCZZIUCYBQXEFF-UHFFFAOYSA-O |
| XLogP | 3.63 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|