C11H15N3O — CID 99990198
3-amino-N-(2,4-dimethylphenyl)-3-iminopropanamide (PubChem CID 99990198) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 3-amino-N-(2,4-dimethylphenyl)-3-iminopropanamide.
| Compound Name | 3-amino-N-(2,4-dimethylphenyl)-3-iminopropanamide |
|---|---|
| PubChem CID | 99990198 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 3-amino-N-(2,4-dimethylphenyl)-3-iminopropanamide |
| SMILES | [H]/N=C(\N)CC(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C11H15N3O/c1-7-3-4-9(8(2)5-7)14-11(15)6-10(12)13/h3-5H,6H2,1-2H3,(H3,12,13)(H,14,15) |
| InChIKey | QASKXCRTMFRTLS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|