C12H16N2O6S2 — CID 58339512
N-[4-(methylsulfonylmethyl)-2-sulfamoylphenyl]-3-oxobutanamide (PubChem CID 58339512) has the molecular formula C12H16N2O6S2 and a molecular weight of 348.40 g/mol. Its IUPAC name is N-[4-(methylsulfonylmethyl)-2-sulfamoylphenyl]-3-oxobutanamide.
| Compound Name | N-[4-(methylsulfonylmethyl)-2-sulfamoylphenyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 58339512 |
| Molecular Formula | C12H16N2O6S2 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | N-[4-(methylsulfonylmethyl)-2-sulfamoylphenyl]-3-oxobutanamide |
| SMILES | CC(=O)CC(=O)Nc1ccc(CS(C)(=O)=O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C12H16N2O6S2/c1-8(15)5-12(16)14-10-4-3-9(7-21(2,17)18)6-11(10)22(13,19)20/h3-4,6H,5,7H2,1-2H3,(H,14,16)(H2,13,19,20) |
| InChIKey | ITVDWVIQQFYHBV-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 140.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|