C10H13FN2O3S — CID 126541767
N-(2,3-dimethyl-4-sulfamoylphenyl)-2-fluoroacetamide (PubChem CID 126541767) has the molecular formula C10H13FN2O3S and a molecular weight of 260.29 g/mol. Its IUPAC name is N-(2,3-dimethyl-4-sulfamoylphenyl)-2-fluoroacetamide.
| Compound Name | N-(2,3-dimethyl-4-sulfamoylphenyl)-2-fluoroacetamide |
|---|---|
| PubChem CID | 126541767 |
| Molecular Formula | C10H13FN2O3S |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | N-(2,3-dimethyl-4-sulfamoylphenyl)-2-fluoroacetamide |
| SMILES | Cc1c(NC(=O)CF)ccc(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C10H13FN2O3S/c1-6-7(2)9(17(12,15)16)4-3-8(6)13-10(14)5-11/h3-4H,5H2,1-2H3,(H,13,14)(H2,12,15,16) |
| InChIKey | OFQALWBHLREINP-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |