C19H29N3O2 — CID 155441269
6-[(3-methylphenyl)methylamino]-2-[1-(prop-2-enylamino)ethenylamino]hexanoic acid (PubChem CID 155441269) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 6-[(3-methylphenyl)methylamino]-2-[1-(prop-2-enylamino)ethenylamino]hexanoic acid.
| Compound Name | 6-[(3-methylphenyl)methylamino]-2-[1-(prop-2-enylamino)ethenylamino]hexanoic acid |
|---|---|
| PubChem CID | 155441269 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 6-[(3-methylphenyl)methylamino]-2-[1-(prop-2-enylamino)ethenylamino]hexanoic acid |
| SMILES | C=CCNC(=C)NC(CCCCNCc1cccc(C)c1)C(=O)O |
| InChI | InChI=1S/C19H29N3O2/c1-4-11-21-16(3)22-18(19(23)24)10-5-6-12-20-14-17-9-7-8-15(2)13-17/h4,7-9,13,18,20-22H,1,3,5-6,10-12,14H2,2H3,(H,23,24) |
| InChIKey | BNIROKYVENXLBY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|