C36H60N8O15 — CID 118030793
2-[[1-carboxy-5-[[4-[[[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]methyl]cyclohexanecarbonyl]amino]pentyl]carbamoylamino]pentanedioic acid (PubChem CID 118030793) has the molecular formula C36H60N8O15 and a molecular weight of 844.92 g/mol. Its IUPAC name is 2-[[1-carboxy-5-[[4-[[[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]methyl]cyclohexanecarbonyl]amino]pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | 2-[[1-carboxy-5-[[4-[[[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]methyl]cyclohexanecarbonyl]amino]pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 118030793 |
| Molecular Formula | C36H60N8O15 |
| Molecular Weight | 844.92 g/mol |
| Exact Mass | 844.42 |
| IUPAC Name | 2-[[1-carboxy-5-[[4-[[[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]methyl]cyclohexanecarbonyl]amino]pentyl]carbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)NC(CCCCNC(=O)C1CCC(CNC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)CC1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C36H60N8O15/c45-28(20-41-11-13-42(21-30(48)49)15-17-44(23-32(52)53)18-16-43(14-12-41)22-31(50)51)38-19-24-4-6-25(7-5-24)33(54)37-10-2-1-3-26(34(55)56)39-36(59)40-27(35(57)58)8-9-29(46)47/h24-27H,1-23H2,(H,37,54)(H,38,45)(H,46,47)(H,48,49)(H,50,51)(H,52,53)(H,55,56)(H,57,58)(H2,39,40,59) |
| InChIKey | WQXBCSQPDGAZOA-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 336.09 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.92 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|