About 4-ethoxybutyl 2-hydroxypropanoate
4-ethoxybutyl 2-hydroxypropanoate (PubChem CID 151280591) has the molecular formula C9H18O4
and a molecular weight of 190.24 g/mol. Its IUPAC name is 4-ethoxybutyl 2-hydroxypropanoate.
Molecular Properties
| Compound Name | 4-ethoxybutyl 2-hydroxypropanoate |
| PubChem CID | 151280591 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 4-ethoxybutyl 2-hydroxypropanoate |
| SMILES | CCOCCCCOC(=O)C(C)O |
| InChI | InChI=1S/C9H18O4/c1-3-12-6-4-5-7-13-9(11)8(2)10/h8,10H,3-7H2,1-2H3 |
| InChIKey | NYHBOBNNQGHQPE-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxybutyl 2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxybutyl 2-hydroxypropanoate?
The IUPAC name of 4-ethoxybutyl 2-hydroxypropanoate (CID 151280591) is 4-ethoxybutyl 2-hydroxypropanoate.
What is the SMILES notation for 4-ethoxybutyl 2-hydroxypropanoate?
The canonical SMILES for 4-ethoxybutyl 2-hydroxypropanoate is CCOCCCCOC(=O)C(C)O.
What is the InChIKey of 4-ethoxybutyl 2-hydroxypropanoate?
The InChIKey is NYHBOBNNQGHQPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O4/c1-3-12-6-4-5-7-13-9(11)8(2)10/h8,10H,3-7H2,1-2H3.
What are the key properties of 4-ethoxybutyl 2-hydroxypropanoate?
4-ethoxybutyl 2-hydroxypropanoate has a molecular weight of 190.24 g/mol, XLogP of 0.73, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxybutyl 2-hydroxypropanoate is sourced from PubChem (CID 151280591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).