C7H12F2O3 — CID 88537747
3-ethoxypropyl 2,2-difluoroacetate (PubChem CID 88537747) has the molecular formula C7H12F2O3 and a molecular weight of 182.17 g/mol. Its IUPAC name is 3-ethoxypropyl 2,2-difluoroacetate.
| Compound Name | 3-ethoxypropyl 2,2-difluoroacetate |
|---|---|
| PubChem CID | 88537747 |
| Molecular Formula | C7H12F2O3 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 3-ethoxypropyl 2,2-difluoroacetate |
| SMILES | CCOCCCOC(=O)C(F)F |
| InChI | InChI=1S/C7H12F2O3/c1-2-11-4-3-5-12-7(10)6(8)9/h6H,2-5H2,1H3 |
| InChIKey | GCFZEQCSVLBDTJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|