C19H43NO7Si2 — CID 161444043
N-ethyl-N-[6-trimethoxysilyl-3-(3-trimethoxysilylpropyl)hexyl]acetamide (PubChem CID 161444043) has the molecular formula C19H43NO7Si2 and a molecular weight of 453.73 g/mol. Its IUPAC name is N-ethyl-N-[6-trimethoxysilyl-3-(3-trimethoxysilylpropyl)hexyl]acetamide.
| Compound Name | N-ethyl-N-[6-trimethoxysilyl-3-(3-trimethoxysilylpropyl)hexyl]acetamide |
|---|---|
| PubChem CID | 161444043 |
| Molecular Formula | C19H43NO7Si2 |
| Molecular Weight | 453.73 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | N-ethyl-N-[6-trimethoxysilyl-3-(3-trimethoxysilylpropyl)hexyl]acetamide |
| SMILES | CCN(CCC(CCC[Si](OC)(OC)OC)CCC[Si](OC)(OC)OC)C(C)=O |
| InChI | InChI=1S/C19H43NO7Si2/c1-9-20(18(2)21)15-14-19(12-10-16-28(22-3,23-4)24-5)13-11-17-29(25-6,26-7)27-8/h19H,9-17H2,1-8H3 |
| InChIKey | QDWCFJCSKLRQTD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.73 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|