C16H34F3NO7Si2 — CID 176815905
3,4,4-trifluoro-N,N-bis(3-trimethoxysilylpropyl)butanamide (PubChem CID 176815905) has the molecular formula C16H34F3NO7Si2 and a molecular weight of 465.61 g/mol. Its IUPAC name is 3,4,4-trifluoro-N,N-bis(3-trimethoxysilylpropyl)butanamide.
| Compound Name | 3,4,4-trifluoro-N,N-bis(3-trimethoxysilylpropyl)butanamide |
|---|---|
| PubChem CID | 176815905 |
| Molecular Formula | C16H34F3NO7Si2 |
| Molecular Weight | 465.61 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 3,4,4-trifluoro-N,N-bis(3-trimethoxysilylpropyl)butanamide |
| SMILES | CO[Si](CCCN(CCC[Si](OC)(OC)OC)C(=O)CC(F)C(F)F)(OC)OC |
| InChI | InChI=1S/C16H34F3NO7Si2/c1-22-28(23-2,24-3)11-7-9-20(15(21)13-14(17)16(18)19)10-8-12-29(25-4,26-5)27-6/h14,16H,7-13H2,1-6H3 |
| InChIKey | AJVPWCIWPYGSHP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.61 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|