C16H32F4N2O5Si — CID 90715116
N-[3-[propanoyl(3-trimethoxysilylpropyl)amino]propyl]carbamoyl fluoride;1,2,2-trifluoropropane (PubChem CID 90715116) has the molecular formula C16H32F4N2O5Si and a molecular weight of 436.52 g/mol. Its IUPAC name is N-[3-[propanoyl(3-trimethoxysilylpropyl)amino]propyl]carbamoyl fluoride;1,2,2-trifluoropropane.
| Compound Name | N-[3-[propanoyl(3-trimethoxysilylpropyl)amino]propyl]carbamoyl fluoride;1,2,2-trifluoropropane |
|---|---|
| PubChem CID | 90715116 |
| Molecular Formula | C16H32F4N2O5Si |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | N-[3-[propanoyl(3-trimethoxysilylpropyl)amino]propyl]carbamoyl fluoride;1,2,2-trifluoropropane |
| SMILES | CC(F)(F)CF.CCC(=O)N(CCCNC(=O)F)CCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C13H27FN2O5Si.C3H5F3/c1-5-12(17)16(9-6-8-15-13(14)18)10-7-11-22(19-2,20-3)21-4;1-3(5,6)2-4/h5-11H2,1-4H3,(H,15,18);2H2,1H3 |
| InChIKey | YDENLASOMKUESC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|