About N-methanidyl-3-trimethoxysilyl-N-(3-trimethoxysilylpropyl)propanamide;rutherfordium
N-methanidyl-3-trimethoxysilyl-N-(3-trimethoxysilylpropyl)propanamide;rutherfordium (PubChem CID 162464001) has the molecular formula C13H30NO7RfSi2-
and a molecular weight of 635.56 g/mol. Its IUPAC name is N-methanidyl-3-trimethoxysilyl-N-(3-trimethoxysilylpropyl)propanamide;rutherfordium.
Molecular Properties
| Compound Name | N-methanidyl-3-trimethoxysilyl-N-(3-trimethoxysilylpropyl)propanamide;rutherfordium |
| PubChem CID | 162464001 |
| Molecular Formula | C13H30NO7RfSi2- |
| Molecular Weight | 635.56 g/mol |
| Exact Mass | 635.28 |
| IUPAC Name | N-methanidyl-3-trimethoxysilyl-N-(3-trimethoxysilylpropyl)propanamide;rutherfordium |
| SMILES | [CH2-]N(CCC[Si](OC)(OC)OC)C(=O)CC[Si](OC)(OC)OC.[Rf] |
| InChI | InChI=1S/C13H30NO7Si2.Rf/c1-14(10-8-11-22(16-2,17-3)18-4)13(15)9-12-23(19-5,20-6)21-7;/h1,8-12H2,2-7H3;/q-1; |
| InChIKey | UGPLAZJDPSUVMF-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 635.56 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-methanidyl-3-trimethoxysilyl-N-(3-trimethoxysilylpropyl)propanamide;rutherfordium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methanidyl-3-trimethoxysilyl-N-(3-trimethoxysilylpropyl)propanamide;rutherfordium?
The IUPAC name of N-methanidyl-3-trimethoxysilyl-N-(3-trimethoxysilylpropyl)propanamide;rutherfordium (CID 162464001) is N-methanidyl-3-trimethoxysilyl-N-(3-trimethoxysilylpropyl)propanamide;rutherfordium.
What is the SMILES notation for N-methanidyl-3-trimethoxysilyl-N-(3-trimethoxysilylpropyl)propanamide;rutherfordium?
The canonical SMILES for N-methanidyl-3-trimethoxysilyl-N-(3-trimethoxysilylpropyl)propanamide;rutherfordium is [CH2-]N(CCC[Si](OC)(OC)OC)C(=O)CC[Si](OC)(OC)OC.[Rf].
What is the InChIKey of N-methanidyl-3-trimethoxysilyl-N-(3-trimethoxysilylpropyl)propanamide;rutherfordium?
The InChIKey is UGPLAZJDPSUVMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30NO7Si2.Rf/c1-14(10-8-11-22(16-2,17-3)18-4)13(15)9-12-23(19-5,20-6)21-7;/h1,8-12H2,2-7H3;/q-1;.
What are the key properties of N-methanidyl-3-trimethoxysilyl-N-(3-trimethoxysilylpropyl)propanamide;rutherfordium?
N-methanidyl-3-trimethoxysilyl-N-(3-trimethoxysilylpropyl)propanamide;rutherfordium has a molecular weight of 635.56 g/mol, XLogP of 1.14, 13 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-methanidyl-3-trimethoxysilyl-N-(3-trimethoxysilylpropyl)propanamide;rutherfordium is sourced from PubChem (CID 162464001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).