C27H71NO26Si8 — CID 167678976
ethyl N,N-bis[3-tris(trimethoxysilyloxy)silylpropyl]carbamate (PubChem CID 167678976) has the molecular formula C27H71NO26Si8 and a molecular weight of 1050.53 g/mol. Its IUPAC name is ethyl N,N-bis[3-tris(trimethoxysilyloxy)silylpropyl]carbamate.
| Compound Name | ethyl N,N-bis[3-tris(trimethoxysilyloxy)silylpropyl]carbamate |
|---|---|
| PubChem CID | 167678976 |
| Molecular Formula | C27H71NO26Si8 |
| Molecular Weight | 1050.53 g/mol |
| Exact Mass | 1049.24 |
| IUPAC Name | ethyl N,N-bis[3-tris(trimethoxysilyloxy)silylpropyl]carbamate |
| SMILES | CCOC(=O)N(CCC[Si](O[Si](OC)(OC)OC)(O[Si](OC)(OC)OC)O[Si](OC)(OC)OC)CCC[Si](O[Si](OC)(OC)OC)(O[Si](OC)(OC)OC)O[Si](OC)(OC)OC |
| InChI | InChI=1S/C27H71NO26Si8/c1-20-48-27(29)28(23-21-25-55(49-57(30-2,31-3)32-4,50-58(33-5,34-6)35-7)51-59(36-8,37-9)38-10)24-22-26-56(52-60(39-11,40-12)41-13,53-61(42-14,43-15)44-16)54-62(45-17,46-18)47-19/h20-26H2,1-19H3 |
| InChIKey | FNDYWGOWPUHJOZ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 251.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 26 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1050.53 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 26 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|