C11H28N2O2Si — CID 175939374
4-(3-aminopropyl-methoxy-methylsilyl)oxy-N,N-dimethylbutan-1-amine (PubChem CID 175939374) has the molecular formula C11H28N2O2Si and a molecular weight of 248.44 g/mol. Its IUPAC name is 4-(3-aminopropyl-methoxy-methylsilyl)oxy-N,N-dimethylbutan-1-amine.
| Compound Name | 4-(3-aminopropyl-methoxy-methylsilyl)oxy-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 175939374 |
| Molecular Formula | C11H28N2O2Si |
| Molecular Weight | 248.44 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 4-(3-aminopropyl-methoxy-methylsilyl)oxy-N,N-dimethylbutan-1-amine |
| SMILES | CO[Si](C)(CCCN)OCCCCN(C)C |
| InChI | InChI=1S/C11H28N2O2Si/c1-13(2)9-5-6-10-15-16(4,14-3)11-7-8-12/h5-12H2,1-4H3 |
| InChIKey | STEXMXVLWBMETP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.44 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|